C28H40O6SSi — CID 100954649
[(2R,4aR,7S,8S,8aR)-6-ethylsulfinyl-2-phenyl-8-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 100954649) has the molecular formula C28H40O6SSi and a molecular weight of 532.78 g/mol. Its IUPAC name is [(2R,4aR,7S,8S,8aR)-6-ethylsulfinyl-2-phenyl-8-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(2R,4aR,7S,8S,8aR)-6-ethylsulfinyl-2-phenyl-8-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 100954649 |
| Molecular Formula | C28H40O6SSi |
| Molecular Weight | 532.78 g/mol |
| Exact Mass | 532.23 |
| IUPAC Name | [(2R,4aR,7S,8S,8aR)-6-ethylsulfinyl-2-phenyl-8-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CCS(=O)C1O[C@@H]2CO[C@@H](c3ccccc3)O[C@H]2[C@H](OCc2ccccc2)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H40O6SSi/c1-7-35(29)27-25(34-36(5,6)28(2,3)4)24(30-18-20-14-10-8-11-15-20)23-22(32-27)19-31-26(33-23)21-16-12-9-13-17-21/h8-17,22-27H,7,18-19H2,1-6H3/t22-,23-,24+,25+,26-,27?,35?/m1/s1 |
| InChIKey | QFCJCLIYIJNQAV-JEUPVFGSSA-N |
| XLogP | 5.57 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.78 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|