C19H25NO9S — CID 10072094
[(4aR,6S,7S,8S,8aR)-6-(acetamidomethyl)-7-methylsulfonyloxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] acetate (PubChem CID 10072094) has the molecular formula C19H25NO9S and a molecular weight of 443.47 g/mol. Its IUPAC name is [(4aR,6S,7S,8S,8aR)-6-(acetamidomethyl)-7-methylsulfonyloxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] acetate.
| Compound Name | [(4aR,6S,7S,8S,8aR)-6-(acetamidomethyl)-7-methylsulfonyloxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] acetate |
|---|---|
| PubChem CID | 10072094 |
| Molecular Formula | C19H25NO9S |
| Molecular Weight | 443.47 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | [(4aR,6S,7S,8S,8aR)-6-(acetamidomethyl)-7-methylsulfonyloxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] acetate |
| SMILES | CC(=O)NC[C@@H]1O[C@@H]2COC(c3ccccc3)O[C@H]2[C@H](OC(C)=O)[C@H]1OS(C)(=O)=O |
| InChI | InChI=1S/C19H25NO9S/c1-11(21)20-9-14-17(29-30(3,23)24)18(26-12(2)22)16-15(27-14)10-25-19(28-16)13-7-5-4-6-8-13/h4-8,14-19H,9-10H2,1-3H3,(H,20,21)/t14-,15+,16+,17-,18-,19?/m0/s1 |
| InChIKey | RMCXXFQSDOQOKQ-SIZJJYDESA-N |
| XLogP | 0.28 |
| TPSA | 126.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.47 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|