C18H20Cl6O12S2 — CID 44605925
[(2R,4aR,6S,7R,8S,8aR)-6-methoxy-2-phenyl-7-(2,2,2-trichloroethoxysulfonyloxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] 2,2,2-trichloroethyl sulfate (PubChem CID 44605925) has the molecular formula C18H20Cl6O12S2 and a molecular weight of 705.20 g/mol. Its IUPAC name is [(2R,4aR,6S,7R,8S,8aR)-6-methoxy-2-phenyl-7-(2,2,2-trichloroethoxysulfonyloxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] 2,2,2-trichloroethyl sulfate.
| Compound Name | [(2R,4aR,6S,7R,8S,8aR)-6-methoxy-2-phenyl-7-(2,2,2-trichloroethoxysulfonyloxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] 2,2,2-trichloroethyl sulfate |
|---|---|
| PubChem CID | 44605925 |
| Molecular Formula | C18H20Cl6O12S2 |
| Molecular Weight | 705.20 g/mol |
| Exact Mass | 701.85 |
| IUPAC Name | [(2R,4aR,6S,7R,8S,8aR)-6-methoxy-2-phenyl-7-(2,2,2-trichloroethoxysulfonyloxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] 2,2,2-trichloroethyl sulfate |
| SMILES | CO[C@H]1O[C@@H]2CO[C@@H](c3ccccc3)O[C@H]2[C@H](OS(=O)(=O)OCC(Cl)(Cl)Cl)[C@H]1OS(=O)(=O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C18H20Cl6O12S2/c1-29-16-14(36-38(27,28)32-9-18(22,23)24)13(35-37(25,26)31-8-17(19,20)21)12-11(33-16)7-30-15(34-12)10-5-3-2-4-6-10/h2-6,11-16H,7-9H2,1H3/t11-,12-,13+,14-,15-,16+/m1/s1 |
| InChIKey | MHWPJDHIJCJAOD-AQGHMYMLSA-N |
| XLogP | 3.51 |
| TPSA | 142.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.20 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|