C25H28Cl3NO8S — CID 101491605
[(4aR,6S,7R,8R,8aR)-7-(benzylamino)-2-phenyl-6-prop-2-enoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] 2,2,2-trichloroethyl sulfate (PubChem CID 101491605) has the molecular formula C25H28Cl3NO8S and a molecular weight of 608.92 g/mol. Its IUPAC name is [(4aR,6S,7R,8R,8aR)-7-(benzylamino)-2-phenyl-6-prop-2-enoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] 2,2,2-trichloroethyl sulfate.
| Compound Name | [(4aR,6S,7R,8R,8aR)-7-(benzylamino)-2-phenyl-6-prop-2-enoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] 2,2,2-trichloroethyl sulfate |
|---|---|
| PubChem CID | 101491605 |
| Molecular Formula | C25H28Cl3NO8S |
| Molecular Weight | 608.92 g/mol |
| Exact Mass | 607.06 |
| IUPAC Name | [(4aR,6S,7R,8R,8aR)-7-(benzylamino)-2-phenyl-6-prop-2-enoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] 2,2,2-trichloroethyl sulfate |
| SMILES | C=CCO[C@H]1O[C@@H]2COC(c3ccccc3)O[C@H]2[C@H](OS(=O)(=O)OCC(Cl)(Cl)Cl)[C@H]1NCc1ccccc1 |
| InChI | InChI=1S/C25H28Cl3NO8S/c1-2-13-32-24-20(29-14-17-9-5-3-6-10-17)22(37-38(30,31)34-16-25(26,27)28)21-19(35-24)15-33-23(36-21)18-11-7-4-8-12-18/h2-12,19-24,29H,1,13-16H2/t19-,20-,21-,22-,23?,24+/m1/s1 |
| InChIKey | IQDMYVYLDXTFOF-AUQUAXPWSA-N |
| XLogP | 4.20 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.92 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|