C31H32N2O7 — CID 122212391
(4aR,6R,7S,8S,8aS)-2-phenyl-7-prop-2-enoxy-6-[4-[(4-prop-2-enoxyphenyl)diazenyl]phenoxy]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol (PubChem CID 122212391) has the molecular formula C31H32N2O7 and a molecular weight of 544.60 g/mol. Its IUPAC name is (4aR,6R,7S,8S,8aS)-2-phenyl-7-prop-2-enoxy-6-[4-[(4-prop-2-enoxyphenyl)diazenyl]phenoxy]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol.
| Compound Name | (4aR,6R,7S,8S,8aS)-2-phenyl-7-prop-2-enoxy-6-[4-[(4-prop-2-enoxyphenyl)diazenyl]phenoxy]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol |
|---|---|
| PubChem CID | 122212391 |
| Molecular Formula | C31H32N2O7 |
| Molecular Weight | 544.60 g/mol |
| Exact Mass | 544.22 |
| IUPAC Name | (4aR,6R,7S,8S,8aS)-2-phenyl-7-prop-2-enoxy-6-[4-[(4-prop-2-enoxyphenyl)diazenyl]phenoxy]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol |
| SMILES | C=CCOc1ccc(/N=N/c2ccc(O[C@H]3O[C@@H]4COC(c5ccccc5)O[C@H]4[C@H](O)[C@@H]3OCC=C)cc2)cc1 |
| InChI | InChI=1S/C31H32N2O7/c1-3-18-35-24-14-10-22(11-15-24)32-33-23-12-16-25(17-13-23)38-31-29(36-19-4-2)27(34)28-26(39-31)20-37-30(40-28)21-8-6-5-7-9-21/h3-17,26-31,34H,1-2,18-20H2/b33-32+/t26-,27+,28-,29+,30?,31+/m1/s1 |
| InChIKey | UGMIMZCJOKDYOR-SSXZTWGYSA-N |
| XLogP | 5.82 |
| TPSA | 100.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.60 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|