C24H28O7 — CID 11640519
[(2R,4aR,6S,7R,8S,8aS)-8-hydroxy-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] deca-4,6-diynoate (PubChem CID 11640519) has the molecular formula C24H28O7 and a molecular weight of 428.48 g/mol. Its IUPAC name is [(2R,4aR,6S,7R,8S,8aS)-8-hydroxy-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] deca-4,6-diynoate.
| Compound Name | [(2R,4aR,6S,7R,8S,8aS)-8-hydroxy-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] deca-4,6-diynoate |
|---|---|
| PubChem CID | 11640519 |
| Molecular Formula | C24H28O7 |
| Molecular Weight | 428.48 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | [(2R,4aR,6S,7R,8S,8aS)-8-hydroxy-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] deca-4,6-diynoate |
| SMILES | CCCC#CC#CCCC(=O)O[C@H]1[C@@H](OC)O[C@@H]2CO[C@@H](c3ccccc3)O[C@H]2[C@@H]1O |
| InChI | InChI=1S/C24H28O7/c1-3-4-5-6-7-8-12-15-19(25)30-22-20(26)21-18(29-24(22)27-2)16-28-23(31-21)17-13-10-9-11-14-17/h9-11,13-14,18,20-24,26H,3-4,12,15-16H2,1-2H3/t18-,20+,21-,22-,23-,24+/m1/s1 |
| InChIKey | KCTATBPWZNKLEE-BLSGDLLQSA-N |
| XLogP | 2.33 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.48 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|