C18H22O7 — CID 102286772
[(4aR,6S,7R,8S,8aS)-8-hydroxy-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] 2-methylprop-2-enoate (PubChem CID 102286772) has the molecular formula C18H22O7 and a molecular weight of 350.37 g/mol. Its IUPAC name is [(4aR,6S,7R,8S,8aS)-8-hydroxy-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] 2-methylprop-2-enoate.
| Compound Name | [(4aR,6S,7R,8S,8aS)-8-hydroxy-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 102286772 |
| Molecular Formula | C18H22O7 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | [(4aR,6S,7R,8S,8aS)-8-hydroxy-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)O[C@H]1[C@@H](OC)O[C@@H]2COC(c3ccccc3)O[C@H]2[C@@H]1O |
| InChI | InChI=1S/C18H22O7/c1-10(2)16(20)24-15-13(19)14-12(23-18(15)21-3)9-22-17(25-14)11-7-5-4-6-8-11/h4-8,12-15,17-19H,1,9H2,2-3H3/t12-,13+,14-,15-,17?,18+/m1/s1 |
| InChIKey | IDOYOAGCSGXVSB-FNXCDFQESA-N |
| XLogP | 1.32 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|