C27H36O7Si — CID 11591432
[(2R,4aR,6S,7R,8R,8aR)-7-hydroxy-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] 7-triethylsilylhepta-4,6-diynoate (PubChem CID 11591432) has the molecular formula C27H36O7Si and a molecular weight of 500.66 g/mol. Its IUPAC name is [(2R,4aR,6S,7R,8R,8aR)-7-hydroxy-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] 7-triethylsilylhepta-4,6-diynoate.
| Compound Name | [(2R,4aR,6S,7R,8R,8aR)-7-hydroxy-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] 7-triethylsilylhepta-4,6-diynoate |
|---|---|
| PubChem CID | 11591432 |
| Molecular Formula | C27H36O7Si |
| Molecular Weight | 500.66 g/mol |
| Exact Mass | 500.22 |
| IUPAC Name | [(2R,4aR,6S,7R,8R,8aR)-7-hydroxy-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] 7-triethylsilylhepta-4,6-diynoate |
| SMILES | CC[Si](C#CC#CCCC(=O)O[C@@H]1[C@@H](O)[C@@H](OC)O[C@@H]2CO[C@@H](c3ccccc3)O[C@@H]12)(CC)CC |
| InChI | InChI=1S/C27H36O7Si/c1-5-35(6-2,7-3)18-14-9-8-13-17-22(28)33-25-23(29)27(30-4)32-21-19-31-26(34-24(21)25)20-15-11-10-12-16-20/h10-12,15-16,21,23-27,29H,5-7,13,17,19H2,1-4H3/t21-,23-,24-,25-,26-,27+/m1/s1 |
| InChIKey | IRWLDBOQDHVIGE-WKLVWBGLSA-N |
| XLogP | 3.58 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.66 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|