C15H18O4 — CID 130283147
(1R,6R,8S)-10-phenyl-5,9,11-trioxatricyclo[6.4.0.02,6]dodecan-4-ol (PubChem CID 130283147) has the molecular formula C15H18O4 and a molecular weight of 262.30 g/mol. Its IUPAC name is (1R,6R,8S)-10-phenyl-5,9,11-trioxatricyclo[6.4.0.02,6]dodecan-4-ol.
| Compound Name | (1R,6R,8S)-10-phenyl-5,9,11-trioxatricyclo[6.4.0.02,6]dodecan-4-ol |
|---|---|
| PubChem CID | 130283147 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | (1R,6R,8S)-10-phenyl-5,9,11-trioxatricyclo[6.4.0.02,6]dodecan-4-ol |
| SMILES | OC1CC2[C@@H](C[C@@H]3OC(c4ccccc4)OC[C@@H]23)O1 |
| InChI | InChI=1S/C15H18O4/c16-14-6-10-11-8-17-15(9-4-2-1-3-5-9)19-13(11)7-12(10)18-14/h1-5,10-16H,6-8H2/t10?,11-,12+,13-,14?,15?/m0/s1 |
| InChIKey | LHBOUJHGCJAIPU-AKGKQIBUSA-N |
| XLogP | 1.84 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |