C15H16O5 — CID 24895717
(1R,3R,7R,9R,11S)-11-phenyl-2,6,10,12-tetraoxatricyclo[7.4.0.03,7]tridecan-5-one (PubChem CID 24895717) has the molecular formula C15H16O5 and a molecular weight of 276.29 g/mol. Its IUPAC name is (1R,3R,7R,9R,11S)-11-phenyl-2,6,10,12-tetraoxatricyclo[7.4.0.03,7]tridecan-5-one.
| Compound Name | (1R,3R,7R,9R,11S)-11-phenyl-2,6,10,12-tetraoxatricyclo[7.4.0.03,7]tridecan-5-one |
|---|---|
| PubChem CID | 24895717 |
| Molecular Formula | C15H16O5 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | (1R,3R,7R,9R,11S)-11-phenyl-2,6,10,12-tetraoxatricyclo[7.4.0.03,7]tridecan-5-one |
| SMILES | O=C1C[C@H]2O[C@@H]3CO[C@H](c4ccccc4)O[C@@H]3C[C@H]2O1 |
| InChI | InChI=1S/C15H16O5/c16-14-7-12-10(19-14)6-11-13(18-12)8-17-15(20-11)9-4-2-1-3-5-9/h1-5,10-13,15H,6-8H2/t10-,11-,12-,13-,15+/m1/s1 |
| InChIKey | QZJFEMDKSCQARF-HVNMYJMUSA-N |
| XLogP | 1.57 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |