C20H24O7 — CID 11440277
(1S,3R,6R,8S,10R,12S,13S,17R)-13-hydroxy-12-methyl-6-phenyl-2,5,7,11,16-pentaoxatetracyclo[8.8.0.03,8.012,17]octadecan-15-one (PubChem CID 11440277) has the molecular formula C20H24O7 and a molecular weight of 376.41 g/mol. Its IUPAC name is (1S,3R,6R,8S,10R,12S,13S,17R)-13-hydroxy-12-methyl-6-phenyl-2,5,7,11,16-pentaoxatetracyclo[8.8.0.03,8.012,17]octadecan-15-one.
| Compound Name | (1S,3R,6R,8S,10R,12S,13S,17R)-13-hydroxy-12-methyl-6-phenyl-2,5,7,11,16-pentaoxatetracyclo[8.8.0.03,8.012,17]octadecan-15-one |
|---|---|
| PubChem CID | 11440277 |
| Molecular Formula | C20H24O7 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | (1S,3R,6R,8S,10R,12S,13S,17R)-13-hydroxy-12-methyl-6-phenyl-2,5,7,11,16-pentaoxatetracyclo[8.8.0.03,8.012,17]octadecan-15-one |
| SMILES | C[C@@]12O[C@@H]3C[C@@H]4O[C@H](c5ccccc5)OC[C@H]4O[C@H]3C[C@H]1OC(=O)C[C@@H]2O |
| InChI | InChI=1S/C20H24O7/c1-20-16(21)9-18(22)26-17(20)8-13-14(27-20)7-12-15(24-13)10-23-19(25-12)11-5-3-2-4-6-11/h2-6,12-17,19,21H,7-10H2,1H3/t12-,13-,14+,15+,16-,17+,19+,20-/m0/s1 |
| InChIKey | ZZAJDYQNVIUCQY-AYLCPGAOSA-N |
| XLogP | 1.48 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |