C15H20O6 — CID 54194947
(4aR,6S,7R,8S,8aS)-6-methoxy-7-methyl-2-phenyl-4a,6,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxine-7,8-diol (PubChem CID 54194947) has the molecular formula C15H20O6 and a molecular weight of 296.32 g/mol. Its IUPAC name is (4aR,6S,7R,8S,8aS)-6-methoxy-7-methyl-2-phenyl-4a,6,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxine-7,8-diol.
| Compound Name | (4aR,6S,7R,8S,8aS)-6-methoxy-7-methyl-2-phenyl-4a,6,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxine-7,8-diol |
|---|---|
| PubChem CID | 54194947 |
| Molecular Formula | C15H20O6 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | (4aR,6S,7R,8S,8aS)-6-methoxy-7-methyl-2-phenyl-4a,6,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxine-7,8-diol |
| SMILES | CO[C@H]1O[C@@H]2COC(c3ccccc3)O[C@H]2[C@H](O)[C@@]1(C)O |
| InChI | InChI=1S/C15H20O6/c1-15(17)12(16)11-10(20-14(15)18-2)8-19-13(21-11)9-6-4-3-5-7-9/h3-7,10-14,16-17H,8H2,1-2H3/t10-,11-,12+,13?,14+,15-/m1/s1 |
| InChIKey | PLDDCPWVDXQATL-CXRDHPDISA-N |
| XLogP | 0.58 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |