C20H24O5 — CID 16720781
1-[(1S,3R,6R,8S,10R,12S)-3-methyl-13-methylidene-6-phenyl-2,5,7,11-tetraoxatricyclo[8.4.0.03,8]tetradecan-12-yl]ethanone (PubChem CID 16720781) has the molecular formula C20H24O5 and a molecular weight of 344.41 g/mol. Its IUPAC name is 1-[(1S,3R,6R,8S,10R,12S)-3-methyl-13-methylidene-6-phenyl-2,5,7,11-tetraoxatricyclo[8.4.0.03,8]tetradecan-12-yl]ethanone.
| Compound Name | 1-[(1S,3R,6R,8S,10R,12S)-3-methyl-13-methylidene-6-phenyl-2,5,7,11-tetraoxatricyclo[8.4.0.03,8]tetradecan-12-yl]ethanone |
|---|---|
| PubChem CID | 16720781 |
| Molecular Formula | C20H24O5 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | 1-[(1S,3R,6R,8S,10R,12S)-3-methyl-13-methylidene-6-phenyl-2,5,7,11-tetraoxatricyclo[8.4.0.03,8]tetradecan-12-yl]ethanone |
| SMILES | C=C1C[C@@H]2O[C@]3(C)CO[C@@H](c4ccccc4)O[C@H]3C[C@H]2O[C@@H]1C(C)=O |
| InChI | InChI=1S/C20H24O5/c1-12-9-16-15(23-18(12)13(2)21)10-17-20(3,25-16)11-22-19(24-17)14-7-5-4-6-8-14/h4-8,15-19H,1,9-11H2,2-3H3/t15-,16+,17+,18+,19-,20-/m1/s1 |
| InChIKey | LRCKXCZVAAYYBN-UHBLESBASA-N |
| XLogP | 2.95 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|