C12H16O4 — CID 11736231
(2S,4R,5S)-4-(hydroxymethyl)-5-methyl-2-phenyl-1,3-dioxan-5-ol (PubChem CID 11736231) has the molecular formula C12H16O4 and a molecular weight of 224.26 g/mol. Its IUPAC name is (2S,4R,5S)-4-(hydroxymethyl)-5-methyl-2-phenyl-1,3-dioxan-5-ol.
| Compound Name | (2S,4R,5S)-4-(hydroxymethyl)-5-methyl-2-phenyl-1,3-dioxan-5-ol |
|---|---|
| PubChem CID | 11736231 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | (2S,4R,5S)-4-(hydroxymethyl)-5-methyl-2-phenyl-1,3-dioxan-5-ol |
| SMILES | C[C@]1(O)CO[C@H](c2ccccc2)O[C@@H]1CO |
| InChI | InChI=1S/C12H16O4/c1-12(14)8-15-11(16-10(12)7-13)9-5-3-2-4-6-9/h2-6,10-11,13-14H,7-8H2,1H3/t10-,11+,12+/m1/s1 |
| InChIKey | JHJFGCPLHDPBDJ-WOPDTQHZSA-N |
| XLogP | 0.84 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |