C13H16O4 — CID 142132815
methyl 5-methyl-2-phenyl-1,3-dioxane-5-carboxylate (PubChem CID 142132815) has the molecular formula C13H16O4 and a molecular weight of 236.27 g/mol. Its IUPAC name is methyl 5-methyl-2-phenyl-1,3-dioxane-5-carboxylate.
| Compound Name | methyl 5-methyl-2-phenyl-1,3-dioxane-5-carboxylate |
|---|---|
| PubChem CID | 142132815 |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | methyl 5-methyl-2-phenyl-1,3-dioxane-5-carboxylate |
| SMILES | COC(=O)C1(C)COC(c2ccccc2)OC1 |
| InChI | InChI=1S/C13H16O4/c1-13(12(14)15-2)8-16-11(17-9-13)10-6-4-3-5-7-10/h3-7,11H,8-9H2,1-2H3 |
| InChIKey | WNXMYQWBMXQPPQ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |