C25H25NO4 — CID 100779046
5-methyl-2-phenyl-N-(4-prop-2-enoxynaphthalen-1-yl)-1,3-dioxane-5-carboxamide (PubChem CID 100779046) has the molecular formula C25H25NO4 and a molecular weight of 403.48 g/mol. Its IUPAC name is 5-methyl-2-phenyl-N-(4-prop-2-enoxynaphthalen-1-yl)-1,3-dioxane-5-carboxamide.
| Compound Name | 5-methyl-2-phenyl-N-(4-prop-2-enoxynaphthalen-1-yl)-1,3-dioxane-5-carboxamide |
|---|---|
| PubChem CID | 100779046 |
| Molecular Formula | C25H25NO4 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | 5-methyl-2-phenyl-N-(4-prop-2-enoxynaphthalen-1-yl)-1,3-dioxane-5-carboxamide |
| SMILES | C=CCOc1ccc(NC(=O)C2(C)COC(c3ccccc3)OC2)c2ccccc12 |
| InChI | InChI=1S/C25H25NO4/c1-3-15-28-22-14-13-21(19-11-7-8-12-20(19)22)26-24(27)25(2)16-29-23(30-17-25)18-9-5-4-6-10-18/h3-14,23H,1,15-17H2,2H3,(H,26,27) |
| InChIKey | HLDRECIHYSISPZ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|