About 5-methyl-2-phenyl-N-(4-prop-2-enoxynaphthalen-1-yl)-1,3-dioxane-5-carboxamide
5-methyl-2-phenyl-N-(4-prop-2-enoxynaphthalen-1-yl)-1,3-dioxane-5-carboxamide (PubChem CID 100779046) has the molecular formula C25H25NO4
and a molecular weight of 403.48 g/mol. Its IUPAC name is 5-methyl-2-phenyl-N-(4-prop-2-enoxynaphthalen-1-yl)-1,3-dioxane-5-carboxamide.
Molecular Properties
| Compound Name | 5-methyl-2-phenyl-N-(4-prop-2-enoxynaphthalen-1-yl)-1,3-dioxane-5-carboxamide |
| PubChem CID | 100779046 |
| Molecular Formula | C25H25NO4 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | 5-methyl-2-phenyl-N-(4-prop-2-enoxynaphthalen-1-yl)-1,3-dioxane-5-carboxamide |
| SMILES | C=CCOc1ccc(NC(=O)C2(C)COC(c3ccccc3)OC2)c2ccccc12 |
| InChI | InChI=1S/C25H25NO4/c1-3-15-28-22-14-13-21(19-11-7-8-12-20(19)22)26-24(27)25(2)16-29-23(30-17-25)18-9-5-4-6-10-18/h3-14,23H,1,15-17H2,2H3,(H,26,27) |
| InChIKey | HLDRECIHYSISPZ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-2-phenyl-N-(4-prop-2-enoxynaphthalen-1-yl)-1,3-dioxane-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-2-phenyl-N-(4-prop-2-enoxynaphthalen-1-yl)-1,3-dioxane-5-carboxamide?
The IUPAC name of 5-methyl-2-phenyl-N-(4-prop-2-enoxynaphthalen-1-yl)-1,3-dioxane-5-carboxamide (CID 100779046) is 5-methyl-2-phenyl-N-(4-prop-2-enoxynaphthalen-1-yl)-1,3-dioxane-5-carboxamide.
What is the SMILES notation for 5-methyl-2-phenyl-N-(4-prop-2-enoxynaphthalen-1-yl)-1,3-dioxane-5-carboxamide?
The canonical SMILES for 5-methyl-2-phenyl-N-(4-prop-2-enoxynaphthalen-1-yl)-1,3-dioxane-5-carboxamide is C=CCOc1ccc(NC(=O)C2(C)COC(c3ccccc3)OC2)c2ccccc12.
What is the InChIKey of 5-methyl-2-phenyl-N-(4-prop-2-enoxynaphthalen-1-yl)-1,3-dioxane-5-carboxamide?
The InChIKey is HLDRECIHYSISPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H25NO4/c1-3-15-28-22-14-13-21(19-11-7-8-12-20(19)22)26-24(27)25(2)16-29-23(30-17-25)18-9-5-4-6-10-18/h3-14,23H,1,15-17H2,2H3,(H,26,27).
What are the key properties of 5-methyl-2-phenyl-N-(4-prop-2-enoxynaphthalen-1-yl)-1,3-dioxane-5-carboxamide?
5-methyl-2-phenyl-N-(4-prop-2-enoxynaphthalen-1-yl)-1,3-dioxane-5-carboxamide has a molecular weight of 403.48 g/mol, XLogP of 5.09, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-2-phenyl-N-(4-prop-2-enoxynaphthalen-1-yl)-1,3-dioxane-5-carboxamide is sourced from PubChem (CID 100779046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).