C29H24ClNO2 — CID 100781562
2-(4-chlorophenyl)-N-(4-prop-2-enoxynaphthalen-1-yl)-1,3-dihydroindene-2-carboxamide (PubChem CID 100781562) has the molecular formula C29H24ClNO2 and a molecular weight of 453.97 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-(4-prop-2-enoxynaphthalen-1-yl)-1,3-dihydroindene-2-carboxamide.
| Compound Name | 2-(4-chlorophenyl)-N-(4-prop-2-enoxynaphthalen-1-yl)-1,3-dihydroindene-2-carboxamide |
|---|---|
| PubChem CID | 100781562 |
| Molecular Formula | C29H24ClNO2 |
| Molecular Weight | 453.97 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | 2-(4-chlorophenyl)-N-(4-prop-2-enoxynaphthalen-1-yl)-1,3-dihydroindene-2-carboxamide |
| SMILES | C=CCOc1ccc(NC(=O)C2(c3ccc(Cl)cc3)Cc3ccccc3C2)c2ccccc12 |
| InChI | InChI=1S/C29H24ClNO2/c1-2-17-33-27-16-15-26(24-9-5-6-10-25(24)27)31-28(32)29(22-11-13-23(30)14-12-22)18-20-7-3-4-8-21(20)19-29/h2-16H,1,17-19H2,(H,31,32) |
| InChIKey | SNVHVVVXQSKNOU-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.97 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|