C24H21ClN2O2 — CID 100781552
2-(4-chlorophenyl)-N-(6-prop-2-enoxy-3-pyridinyl)-1,3-dihydroindene-2-carboxamide (PubChem CID 100781552) has the molecular formula C24H21ClN2O2 and a molecular weight of 404.90 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-(6-prop-2-enoxy-3-pyridinyl)-1,3-dihydroindene-2-carboxamide.
| Compound Name | 2-(4-chlorophenyl)-N-(6-prop-2-enoxy-3-pyridinyl)-1,3-dihydroindene-2-carboxamide |
|---|---|
| PubChem CID | 100781552 |
| Molecular Formula | C24H21ClN2O2 |
| Molecular Weight | 404.90 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | 2-(4-chlorophenyl)-N-(6-prop-2-enoxy-3-pyridinyl)-1,3-dihydroindene-2-carboxamide |
| SMILES | C=CCOc1ccc(NC(=O)C2(c3ccc(Cl)cc3)Cc3ccccc3C2)cn1 |
| InChI | InChI=1S/C24H21ClN2O2/c1-2-13-29-22-12-11-21(16-26-22)27-23(28)24(19-7-9-20(25)10-8-19)14-17-5-3-4-6-18(17)15-24/h2-12,16H,1,13-15H2,(H,27,28) |
| InChIKey | ULWNOGXFANWTCT-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.90 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|