C19H19ClFN3O4S — CID 100780901
1-[(4-chloro-2-fluorophenyl)methylsulfonylamino]-N-(6-prop-2-enoxy-3-pyridinyl)cyclopropane-1-carboxamide (PubChem CID 100780901) has the molecular formula C19H19ClFN3O4S and a molecular weight of 439.90 g/mol. Its IUPAC name is 1-[(4-chloro-2-fluorophenyl)methylsulfonylamino]-N-(6-prop-2-enoxy-3-pyridinyl)cyclopropane-1-carboxamide.
| Compound Name | 1-[(4-chloro-2-fluorophenyl)methylsulfonylamino]-N-(6-prop-2-enoxy-3-pyridinyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 100780901 |
| Molecular Formula | C19H19ClFN3O4S |
| Molecular Weight | 439.90 g/mol |
| Exact Mass | 439.08 |
| IUPAC Name | 1-[(4-chloro-2-fluorophenyl)methylsulfonylamino]-N-(6-prop-2-enoxy-3-pyridinyl)cyclopropane-1-carboxamide |
| SMILES | C=CCOc1ccc(NC(=O)C2(NS(=O)(=O)Cc3ccc(Cl)cc3F)CC2)cn1 |
| InChI | InChI=1S/C19H19ClFN3O4S/c1-2-9-28-17-6-5-15(11-22-17)23-18(25)19(7-8-19)24-29(26,27)12-13-3-4-14(20)10-16(13)21/h2-6,10-11,24H,1,7-9,12H2,(H,23,25) |
| InChIKey | COHQTTNIFPLYTD-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.90 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|