C21H24N2O5 — CID 100779297
2-(4-methoxyphenyl)-5-methyl-N-(6-prop-2-enoxy-3-pyridinyl)-1,3-dioxane-5-carboxamide (PubChem CID 100779297) has the molecular formula C21H24N2O5 and a molecular weight of 384.43 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-5-methyl-N-(6-prop-2-enoxy-3-pyridinyl)-1,3-dioxane-5-carboxamide.
| Compound Name | 2-(4-methoxyphenyl)-5-methyl-N-(6-prop-2-enoxy-3-pyridinyl)-1,3-dioxane-5-carboxamide |
|---|---|
| PubChem CID | 100779297 |
| Molecular Formula | C21H24N2O5 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | 2-(4-methoxyphenyl)-5-methyl-N-(6-prop-2-enoxy-3-pyridinyl)-1,3-dioxane-5-carboxamide |
| SMILES | C=CCOc1ccc(NC(=O)C2(C)COC(c3ccc(OC)cc3)OC2)cn1 |
| InChI | InChI=1S/C21H24N2O5/c1-4-11-26-18-10-7-16(12-22-18)23-20(24)21(2)13-27-19(28-14-21)15-5-8-17(25-3)9-6-15/h4-10,12,19H,1,11,13-14H2,2-3H3,(H,23,24) |
| InChIKey | LATVDXZJOKITIO-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|