C23H23NO4S — CID 100780007
5-methyl-N-(4-prop-2-enoxynaphthalen-1-yl)-2-thiophen-2-yl-1,3-dioxane-5-carboxamide (PubChem CID 100780007) has the molecular formula C23H23NO4S and a molecular weight of 409.51 g/mol. Its IUPAC name is 5-methyl-N-(4-prop-2-enoxynaphthalen-1-yl)-2-thiophen-2-yl-1,3-dioxane-5-carboxamide.
| Compound Name | 5-methyl-N-(4-prop-2-enoxynaphthalen-1-yl)-2-thiophen-2-yl-1,3-dioxane-5-carboxamide |
|---|---|
| PubChem CID | 100780007 |
| Molecular Formula | C23H23NO4S |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | 5-methyl-N-(4-prop-2-enoxynaphthalen-1-yl)-2-thiophen-2-yl-1,3-dioxane-5-carboxamide |
| SMILES | C=CCOc1ccc(NC(=O)C2(C)COC(c3cccs3)OC2)c2ccccc12 |
| InChI | InChI=1S/C23H23NO4S/c1-3-12-26-19-11-10-18(16-7-4-5-8-17(16)19)24-22(25)23(2)14-27-21(28-15-23)20-9-6-13-29-20/h3-11,13,21H,1,12,14-15H2,2H3,(H,24,25) |
| InChIKey | OCQGWWGQFUVXSY-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|