C29H32N2O6S — CID 19233564
1-N,3-N-bis(2-ethoxyphenyl)-4-hydroxy-4-methyl-6-oxo-2-thiophen-2-ylcyclohexane-1,3-dicarboxamide (PubChem CID 19233564) has the molecular formula C29H32N2O6S and a molecular weight of 536.65 g/mol. Its IUPAC name is 1-N,3-N-bis(2-ethoxyphenyl)-4-hydroxy-4-methyl-6-oxo-2-thiophen-2-ylcyclohexane-1,3-dicarboxamide.
| Compound Name | 1-N,3-N-bis(2-ethoxyphenyl)-4-hydroxy-4-methyl-6-oxo-2-thiophen-2-ylcyclohexane-1,3-dicarboxamide |
|---|---|
| PubChem CID | 19233564 |
| Molecular Formula | C29H32N2O6S |
| Molecular Weight | 536.65 g/mol |
| Exact Mass | 536.20 |
| IUPAC Name | 1-N,3-N-bis(2-ethoxyphenyl)-4-hydroxy-4-methyl-6-oxo-2-thiophen-2-ylcyclohexane-1,3-dicarboxamide |
| SMILES | CCOc1ccccc1NC(=O)C1C(=O)CC(C)(O)C(C(=O)Nc2ccccc2OCC)C1c1cccs1 |
| InChI | InChI=1S/C29H32N2O6S/c1-4-36-21-13-8-6-11-18(21)30-27(33)24-20(32)17-29(3,35)26(25(24)23-15-10-16-38-23)28(34)31-19-12-7-9-14-22(19)37-5-2/h6-16,24-26,35H,4-5,17H2,1-3H3,(H,30,33)(H,31,34) |
| InChIKey | YGJFGXRXONXKBW-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.65 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|