About 5,5-bis(methoxymethyl)-2-phenyl-1,3-dioxane
5,5-bis(methoxymethyl)-2-phenyl-1,3-dioxane (PubChem CID 12721367) has the molecular formula C14H20O4
and a molecular weight of 252.31 g/mol. Its IUPAC name is 5,5-bis(methoxymethyl)-2-phenyl-1,3-dioxane.
Molecular Properties
| Compound Name | 5,5-bis(methoxymethyl)-2-phenyl-1,3-dioxane |
| PubChem CID | 12721367 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 5,5-bis(methoxymethyl)-2-phenyl-1,3-dioxane |
| SMILES | COCC1(COC)COC(c2ccccc2)OC1 |
| InChI | InChI=1S/C14H20O4/c1-15-8-14(9-16-2)10-17-13(18-11-14)12-6-4-3-5-7-12/h3-7,13H,8-11H2,1-2H3 |
| InChIKey | KUOCKPGVDFMZBD-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5,5-bis(methoxymethyl)-2-phenyl-1,3-dioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-bis(methoxymethyl)-2-phenyl-1,3-dioxane?
The IUPAC name of 5,5-bis(methoxymethyl)-2-phenyl-1,3-dioxane (CID 12721367) is 5,5-bis(methoxymethyl)-2-phenyl-1,3-dioxane.
What is the SMILES notation for 5,5-bis(methoxymethyl)-2-phenyl-1,3-dioxane?
The canonical SMILES for 5,5-bis(methoxymethyl)-2-phenyl-1,3-dioxane is COCC1(COC)COC(c2ccccc2)OC1.
What is the InChIKey of 5,5-bis(methoxymethyl)-2-phenyl-1,3-dioxane?
The InChIKey is KUOCKPGVDFMZBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20O4/c1-15-8-14(9-16-2)10-17-13(18-11-14)12-6-4-3-5-7-12/h3-7,13H,8-11H2,1-2H3.
What are the key properties of 5,5-bis(methoxymethyl)-2-phenyl-1,3-dioxane?
5,5-bis(methoxymethyl)-2-phenyl-1,3-dioxane has a molecular weight of 252.31 g/mol, XLogP of 2.01, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-bis(methoxymethyl)-2-phenyl-1,3-dioxane is sourced from PubChem (CID 12721367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).