C16H24O4 — CID 12857507
5,5-bis(ethoxymethyl)-2-phenyl-1,3-dioxane (PubChem CID 12857507) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is 5,5-bis(ethoxymethyl)-2-phenyl-1,3-dioxane.
| Compound Name | 5,5-bis(ethoxymethyl)-2-phenyl-1,3-dioxane |
|---|---|
| PubChem CID | 12857507 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | 5,5-bis(ethoxymethyl)-2-phenyl-1,3-dioxane |
| SMILES | CCOCC1(COCC)COC(c2ccccc2)OC1 |
| InChI | InChI=1S/C16H24O4/c1-3-17-10-16(11-18-4-2)12-19-15(20-13-16)14-8-6-5-7-9-14/h5-9,15H,3-4,10-13H2,1-2H3 |
| InChIKey | SOQSKOGSERPTGC-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |