C20H26O4 — CID 142452502
ethane;2-phenyl-5,5-bis(prop-2-ynoxymethyl)-1,3-dioxane (PubChem CID 142452502) has the molecular formula C20H26O4 and a molecular weight of 330.42 g/mol. Its IUPAC name is ethane;2-phenyl-5,5-bis(prop-2-ynoxymethyl)-1,3-dioxane.
| Compound Name | ethane;2-phenyl-5,5-bis(prop-2-ynoxymethyl)-1,3-dioxane |
|---|---|
| PubChem CID | 142452502 |
| Molecular Formula | C20H26O4 |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | ethane;2-phenyl-5,5-bis(prop-2-ynoxymethyl)-1,3-dioxane |
| SMILES | C#CCOCC1(COCC#C)COC(c2ccccc2)OC1.CC |
| InChI | InChI=1S/C18H20O4.C2H6/c1-3-10-19-12-18(13-20-11-4-2)14-21-17(22-15-18)16-8-6-5-7-9-16;1-2/h1-2,5-9,17H,10-15H2;1-2H3 |
| InChIKey | XGTSHOWYKMKOOL-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|