C13H14O3 — CID 134275643
2-phenyl-5-prop-2-ynoxy-1,3-dioxane (PubChem CID 134275643) has the molecular formula C13H14O3 and a molecular weight of 218.25 g/mol. Its IUPAC name is 2-phenyl-5-prop-2-ynoxy-1,3-dioxane.
| Compound Name | 2-phenyl-5-prop-2-ynoxy-1,3-dioxane |
|---|---|
| PubChem CID | 134275643 |
| Molecular Formula | C13H14O3 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 2-phenyl-5-prop-2-ynoxy-1,3-dioxane |
| SMILES | C#CCOC1COC(c2ccccc2)OC1 |
| InChI | InChI=1S/C13H14O3/c1-2-8-14-12-9-15-13(16-10-12)11-6-4-3-5-7-11/h1,3-7,12-13H,8-10H2 |
| InChIKey | NVDLIAVGIJLVFY-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|