C16H16O4 — CID 90892054
2-(4-hydroperoxyphenyl)-5-phenyl-1,3-dioxane (PubChem CID 90892054) has the molecular formula C16H16O4 and a molecular weight of 272.30 g/mol. Its IUPAC name is 2-(4-hydroperoxyphenyl)-5-phenyl-1,3-dioxane.
| Compound Name | 2-(4-hydroperoxyphenyl)-5-phenyl-1,3-dioxane |
|---|---|
| PubChem CID | 90892054 |
| Molecular Formula | C16H16O4 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 2-(4-hydroperoxyphenyl)-5-phenyl-1,3-dioxane |
| SMILES | OOc1ccc(C2OCC(c3ccccc3)CO2)cc1 |
| InChI | InChI=1S/C16H16O4/c17-20-15-8-6-13(7-9-15)16-18-10-14(11-19-16)12-4-2-1-3-5-12/h1-9,14,16-17H,10-11H2 |
| InChIKey | PQYFGHVJDSLVFS-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|