C17H18O4S — CID 90785635
[4-(5-phenyl-1,3-dioxan-2-yl)phenyl] methanesulfinate (PubChem CID 90785635) has the molecular formula C17H18O4S and a molecular weight of 318.39 g/mol. Its IUPAC name is [4-(5-phenyl-1,3-dioxan-2-yl)phenyl] methanesulfinate.
| Compound Name | [4-(5-phenyl-1,3-dioxan-2-yl)phenyl] methanesulfinate |
|---|---|
| PubChem CID | 90785635 |
| Molecular Formula | C17H18O4S |
| Molecular Weight | 318.39 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | [4-(5-phenyl-1,3-dioxan-2-yl)phenyl] methanesulfinate |
| SMILES | CS(=O)Oc1ccc(C2OCC(c3ccccc3)CO2)cc1 |
| InChI | InChI=1S/C17H18O4S/c1-22(18)21-16-9-7-14(8-10-16)17-19-11-15(12-20-17)13-5-3-2-4-6-13/h2-10,15,17H,11-12H2,1H3 |
| InChIKey | FCJKKZCBQQOVHT-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.39 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |