C13H17NO4 — CID 102258181
(2-phenyl-1,3-dioxan-5-yl) (2S)-2-aminopropanoate (PubChem CID 102258181) has the molecular formula C13H17NO4 and a molecular weight of 251.28 g/mol. Its IUPAC name is (2-phenyl-1,3-dioxan-5-yl) (2S)-2-aminopropanoate.
| Compound Name | (2-phenyl-1,3-dioxan-5-yl) (2S)-2-aminopropanoate |
|---|---|
| PubChem CID | 102258181 |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | (2-phenyl-1,3-dioxan-5-yl) (2S)-2-aminopropanoate |
| SMILES | C[C@H](N)C(=O)OC1COC(c2ccccc2)OC1 |
| InChI | InChI=1S/C13H17NO4/c1-9(14)12(15)18-11-7-16-13(17-8-11)10-5-3-2-4-6-10/h2-6,9,11,13H,7-8,14H2,1H3/t9-,11?,13?/m0/s1 |
| InChIKey | SPYZZGNOVXGOTR-FJJSSXBZSA-N |
| XLogP | 0.99 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |