C12H14O3S — CID 10752419
S-(2-phenyl-1,3-dioxan-5-yl) ethanethioate (PubChem CID 10752419) has the molecular formula C12H14O3S and a molecular weight of 238.31 g/mol. Its IUPAC name is S-(2-phenyl-1,3-dioxan-5-yl) ethanethioate.
| Compound Name | S-(2-phenyl-1,3-dioxan-5-yl) ethanethioate |
|---|---|
| PubChem CID | 10752419 |
| Molecular Formula | C12H14O3S |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | S-(2-phenyl-1,3-dioxan-5-yl) ethanethioate |
| SMILES | CC(=O)SC1COC(c2ccccc2)OC1 |
| InChI | InChI=1S/C12H14O3S/c1-9(13)16-11-7-14-12(15-8-11)10-5-3-2-4-6-10/h2-6,11-12H,7-8H2,1H3 |
| InChIKey | ZBXVFAIERREZMA-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|