C11H12O2S — CID 162369787
4-phenyl-3,5-dioxa-8-thiabicyclo[5.1.0]octane (PubChem CID 162369787) has the molecular formula C11H12O2S and a molecular weight of 208.28 g/mol. Its IUPAC name is 4-phenyl-3,5-dioxa-8-thiabicyclo[5.1.0]octane.
| Compound Name | 4-phenyl-3,5-dioxa-8-thiabicyclo[5.1.0]octane |
|---|---|
| PubChem CID | 162369787 |
| Molecular Formula | C11H12O2S |
| Molecular Weight | 208.28 g/mol |
| Exact Mass | 208.06 |
| IUPAC Name | 4-phenyl-3,5-dioxa-8-thiabicyclo[5.1.0]octane |
| SMILES | c1ccc(C2OCC3SC3CO2)cc1 |
| InChI | InChI=1S/C11H12O2S/c1-2-4-8(5-3-1)11-12-6-9-10(14-9)7-13-11/h1-5,9-11H,6-7H2 |
| InChIKey | OCDXLZPXRWWCEQ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.28 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|