C10H11N3O2 — CID 59511058
5-azido-2-phenyl-1,3-dioxane (PubChem CID 59511058) has the molecular formula C10H11N3O2 and a molecular weight of 205.22 g/mol. Its IUPAC name is 5-azido-2-phenyl-1,3-dioxane.
| Compound Name | 5-azido-2-phenyl-1,3-dioxane |
|---|---|
| PubChem CID | 59511058 |
| Molecular Formula | C10H11N3O2 |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 5-azido-2-phenyl-1,3-dioxane |
| SMILES | [N-]=[N+]=NC1COC(c2ccccc2)OC1 |
| InChI | InChI=1S/C10H11N3O2/c11-13-12-9-6-14-10(15-7-9)8-4-2-1-3-5-8/h1-5,9-10H,6-7H2 |
| InChIKey | QACWTGGKNGOTBK-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 67.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|