C11H12N6O2 — CID 102154551
(4S,5R)-5-azido-4-(azidomethyl)-2-phenyl-1,3-dioxane (PubChem CID 102154551) has the molecular formula C11H12N6O2 and a molecular weight of 260.26 g/mol. Its IUPAC name is (4S,5R)-5-azido-4-(azidomethyl)-2-phenyl-1,3-dioxane.
| Compound Name | (4S,5R)-5-azido-4-(azidomethyl)-2-phenyl-1,3-dioxane |
|---|---|
| PubChem CID | 102154551 |
| Molecular Formula | C11H12N6O2 |
| Molecular Weight | 260.26 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | (4S,5R)-5-azido-4-(azidomethyl)-2-phenyl-1,3-dioxane |
| SMILES | [N-]=[N+]=NC[C@@H]1OC(c2ccccc2)OC[C@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C11H12N6O2/c12-16-14-6-10-9(15-17-13)7-18-11(19-10)8-4-2-1-3-5-8/h1-5,9-11H,6-7H2/t9-,10+,11?/m1/s1 |
| InChIKey | LGOGDIQPEYZMSG-JKIOLJMWSA-N |
| XLogP | 3.09 |
| TPSA | 115.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.26 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|