C14H17N3O5 — CID 11850624
(3S,4R)-4-[(4S,5S)-5-azido-2-phenyl-1,3-dioxan-4-yl]-3,4-dihydroxybutan-2-one (PubChem CID 11850624) has the molecular formula C14H17N3O5 and a molecular weight of 307.31 g/mol. Its IUPAC name is (3S,4R)-4-[(4S,5S)-5-azido-2-phenyl-1,3-dioxan-4-yl]-3,4-dihydroxybutan-2-one.
| Compound Name | (3S,4R)-4-[(4S,5S)-5-azido-2-phenyl-1,3-dioxan-4-yl]-3,4-dihydroxybutan-2-one |
|---|---|
| PubChem CID | 11850624 |
| Molecular Formula | C14H17N3O5 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | (3S,4R)-4-[(4S,5S)-5-azido-2-phenyl-1,3-dioxan-4-yl]-3,4-dihydroxybutan-2-one |
| SMILES | CC(=O)[C@@H](O)[C@@H](O)[C@H]1OC(c2ccccc2)OC[C@@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C14H17N3O5/c1-8(18)11(19)12(20)13-10(16-17-15)7-21-14(22-13)9-5-3-2-4-6-9/h2-6,10-14,19-20H,7H2,1H3/t10-,11+,12+,13-,14?/m0/s1 |
| InChIKey | YVHCRXPOVCQOLN-DSPUWRHFSA-N |
| XLogP | 1.09 |
| TPSA | 124.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|