C18H27N3O2 — CID 11109920
4-(9-azidononyl)-2-phenyl-1,3-dioxolane (PubChem CID 11109920) has the molecular formula C18H27N3O2 and a molecular weight of 317.43 g/mol. Its IUPAC name is 4-(9-azidononyl)-2-phenyl-1,3-dioxolane.
| Compound Name | 4-(9-azidononyl)-2-phenyl-1,3-dioxolane |
|---|---|
| PubChem CID | 11109920 |
| Molecular Formula | C18H27N3O2 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.21 |
| IUPAC Name | 4-(9-azidononyl)-2-phenyl-1,3-dioxolane |
| SMILES | [N-]=[N+]=NCCCCCCCCCC1COC(c2ccccc2)O1 |
| InChI | InChI=1S/C18H27N3O2/c19-21-20-14-10-5-3-1-2-4-9-13-17-15-22-18(23-17)16-11-7-6-8-12-16/h6-8,11-12,17-18H,1-5,9-10,13-15H2 |
| InChIKey | LCPLDJXGPHTZIG-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 67.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|