C29H34FN5O6 — CID 129036758
5-azido-N-[3-[4-[4-[4-(1,3-dioxoisoindol-2-yl)butyl]-1,3-dioxolan-2-yl]-2-fluorophenoxy]propyl]pentanamide (PubChem CID 129036758) has the molecular formula C29H34FN5O6 and a molecular weight of 567.62 g/mol. Its IUPAC name is 5-azido-N-[3-[4-[4-[4-(1,3-dioxoisoindol-2-yl)butyl]-1,3-dioxolan-2-yl]-2-fluorophenoxy]propyl]pentanamide.
| Compound Name | 5-azido-N-[3-[4-[4-[4-(1,3-dioxoisoindol-2-yl)butyl]-1,3-dioxolan-2-yl]-2-fluorophenoxy]propyl]pentanamide |
|---|---|
| PubChem CID | 129036758 |
| Molecular Formula | C29H34FN5O6 |
| Molecular Weight | 567.62 g/mol |
| Exact Mass | 567.25 |
| IUPAC Name | 5-azido-N-[3-[4-[4-[4-(1,3-dioxoisoindol-2-yl)butyl]-1,3-dioxolan-2-yl]-2-fluorophenoxy]propyl]pentanamide |
| SMILES | [N-]=[N+]=NCCCCC(=O)NCCCOc1ccc(C2OCC(CCCCN3C(=O)c4ccccc4C3=O)O2)cc1F |
| InChI | InChI=1S/C29H34FN5O6/c30-24-18-20(12-13-25(24)39-17-7-14-32-26(36)11-3-5-15-33-34-31)29-40-19-21(41-29)8-4-6-16-35-27(37)22-9-1-2-10-23(22)28(35)38/h1-2,9-10,12-13,18,21,29H,3-8,11,14-17,19H2,(H,32,36) |
| InChIKey | HEINERJLZRUCQC-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 142.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.62 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|