C28H34FNO7 — CID 129036752
2-[4-[2-[4-(2,3-diethoxypropoxy)-3-fluorophenyl]-1,3-dioxolan-4-yl]butyl]isoindole-1,3-dione (PubChem CID 129036752) has the molecular formula C28H34FNO7 and a molecular weight of 515.58 g/mol. Its IUPAC name is 2-[4-[2-[4-(2,3-diethoxypropoxy)-3-fluorophenyl]-1,3-dioxolan-4-yl]butyl]isoindole-1,3-dione.
| Compound Name | 2-[4-[2-[4-(2,3-diethoxypropoxy)-3-fluorophenyl]-1,3-dioxolan-4-yl]butyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 129036752 |
| Molecular Formula | C28H34FNO7 |
| Molecular Weight | 515.58 g/mol |
| Exact Mass | 515.23 |
| IUPAC Name | 2-[4-[2-[4-(2,3-diethoxypropoxy)-3-fluorophenyl]-1,3-dioxolan-4-yl]butyl]isoindole-1,3-dione |
| SMILES | CCOCC(COc1ccc(C2OCC(CCCCN3C(=O)c4ccccc4C3=O)O2)cc1F)OCC |
| InChI | InChI=1S/C28H34FNO7/c1-3-33-16-21(34-4-2)18-35-25-13-12-19(15-24(25)29)28-36-17-20(37-28)9-7-8-14-30-26(31)22-10-5-6-11-23(22)27(30)32/h5-6,10-13,15,20-21,28H,3-4,7-9,14,16-18H2,1-2H3 |
| InChIKey | MUYHNOJMAUNXGH-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.58 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|