C24H27F4NO9 — CID 158868752
(2,5-dioxopyrrolidin-1-yl) 4-[2-[3-fluoro-4-(6,6,6-trifluoro-5-oxohexoxy)phenyl]-1,3-dioxolan-4-yl]butyl carbonate (PubChem CID 158868752) has the molecular formula C24H27F4NO9 and a molecular weight of 549.47 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 4-[2-[3-fluoro-4-(6,6,6-trifluoro-5-oxohexoxy)phenyl]-1,3-dioxolan-4-yl]butyl carbonate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 4-[2-[3-fluoro-4-(6,6,6-trifluoro-5-oxohexoxy)phenyl]-1,3-dioxolan-4-yl]butyl carbonate |
|---|---|
| PubChem CID | 158868752 |
| Molecular Formula | C24H27F4NO9 |
| Molecular Weight | 549.47 g/mol |
| Exact Mass | 549.16 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 4-[2-[3-fluoro-4-(6,6,6-trifluoro-5-oxohexoxy)phenyl]-1,3-dioxolan-4-yl]butyl carbonate |
| SMILES | O=C(OCCCCC1COC(c2ccc(OCCCCC(=O)C(F)(F)F)c(F)c2)O1)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C24H27F4NO9/c25-17-13-15(7-8-18(17)34-11-4-2-6-19(30)24(26,27)28)22-36-14-16(37-22)5-1-3-12-35-23(33)38-29-20(31)9-10-21(29)32/h7-8,13,16,22H,1-6,9-12,14H2 |
| InChIKey | JBOPKPPZTBSDRI-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 117.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.47 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|