C36H51FO5 — CID 19083476
[4-(5-octyl-1,3-dioxan-2-yl)phenyl] 4-(6-cyclopentylhexoxy)-3-fluorobenzoate (PubChem CID 19083476) has the molecular formula C36H51FO5 and a molecular weight of 582.80 g/mol. Its IUPAC name is [4-(5-octyl-1,3-dioxan-2-yl)phenyl] 4-(6-cyclopentylhexoxy)-3-fluorobenzoate.
| Compound Name | [4-(5-octyl-1,3-dioxan-2-yl)phenyl] 4-(6-cyclopentylhexoxy)-3-fluorobenzoate |
|---|---|
| PubChem CID | 19083476 |
| Molecular Formula | C36H51FO5 |
| Molecular Weight | 582.80 g/mol |
| Exact Mass | 582.37 |
| IUPAC Name | [4-(5-octyl-1,3-dioxan-2-yl)phenyl] 4-(6-cyclopentylhexoxy)-3-fluorobenzoate |
| SMILES | CCCCCCCCC1COC(c2ccc(OC(=O)c3ccc(OCCCCCCC4CCCC4)c(F)c3)cc2)OC1 |
| InChI | InChI=1S/C36H51FO5/c1-2-3-4-5-6-10-17-29-26-40-36(41-27-29)30-18-21-32(22-19-30)42-35(38)31-20-23-34(33(37)25-31)39-24-13-8-7-9-14-28-15-11-12-16-28/h18-23,25,28-29,36H,2-17,24,26-27H2,1H3 |
| InChIKey | JIDQHXWGHYCWPU-UHFFFAOYSA-N |
| XLogP | 9.98 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.80 |
| LogP ≤ 5 | 9.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|