About amino 4-(oxiran-2-yl)butyl carbonate
amino 4-(oxiran-2-yl)butyl carbonate (PubChem CID 147727431) has the molecular formula C7H13NO4
and a molecular weight of 175.18 g/mol. Its IUPAC name is amino 4-(oxiran-2-yl)butyl carbonate.
Molecular Properties
| Compound Name | amino 4-(oxiran-2-yl)butyl carbonate |
| PubChem CID | 147727431 |
| Molecular Formula | C7H13NO4 |
| Molecular Weight | 175.18 g/mol |
| Exact Mass | 175.08 |
| IUPAC Name | amino 4-(oxiran-2-yl)butyl carbonate |
| SMILES | NOC(=O)OCCCCC1CO1 |
| InChI | InChI=1S/C7H13NO4/c8-12-7(9)10-4-2-1-3-6-5-11-6/h6H,1-5,8H2 |
| InChIKey | GXTNQPYXXSGEJG-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 74.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.18 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze amino 4-(oxiran-2-yl)butyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of amino 4-(oxiran-2-yl)butyl carbonate?
The IUPAC name of amino 4-(oxiran-2-yl)butyl carbonate (CID 147727431) is amino 4-(oxiran-2-yl)butyl carbonate.
What is the SMILES notation for amino 4-(oxiran-2-yl)butyl carbonate?
The canonical SMILES for amino 4-(oxiran-2-yl)butyl carbonate is NOC(=O)OCCCCC1CO1.
What is the InChIKey of amino 4-(oxiran-2-yl)butyl carbonate?
The InChIKey is GXTNQPYXXSGEJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO4/c8-12-7(9)10-4-2-1-3-6-5-11-6/h6H,1-5,8H2.
What are the key properties of amino 4-(oxiran-2-yl)butyl carbonate?
amino 4-(oxiran-2-yl)butyl carbonate has a molecular weight of 175.18 g/mol, XLogP of 0.58, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for amino 4-(oxiran-2-yl)butyl carbonate is sourced from PubChem (CID 147727431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).