C30H36FN5O7 — CID 131998633
5-azido-N-[2-[2-[4-[4-[4-(1,3-dioxoisoindol-2-yl)butyl]-1,3-dioxolan-2-yl]-2-fluorophenoxy]ethoxy]ethyl]pentanamide (PubChem CID 131998633) has the molecular formula C30H36FN5O7 and a molecular weight of 597.64 g/mol. Its IUPAC name is 5-azido-N-[2-[2-[4-[4-[4-(1,3-dioxoisoindol-2-yl)butyl]-1,3-dioxolan-2-yl]-2-fluorophenoxy]ethoxy]ethyl]pentanamide.
| Compound Name | 5-azido-N-[2-[2-[4-[4-[4-(1,3-dioxoisoindol-2-yl)butyl]-1,3-dioxolan-2-yl]-2-fluorophenoxy]ethoxy]ethyl]pentanamide |
|---|---|
| PubChem CID | 131998633 |
| Molecular Formula | C30H36FN5O7 |
| Molecular Weight | 597.64 g/mol |
| Exact Mass | 597.26 |
| IUPAC Name | 5-azido-N-[2-[2-[4-[4-[4-(1,3-dioxoisoindol-2-yl)butyl]-1,3-dioxolan-2-yl]-2-fluorophenoxy]ethoxy]ethyl]pentanamide |
| SMILES | [N-]=[N+]=NCCCCC(=O)NCCOCCOc1ccc(C2OCC(CCCCN3C(=O)c4ccccc4C3=O)O2)cc1F |
| InChI | InChI=1S/C30H36FN5O7/c31-25-19-21(11-12-26(25)41-18-17-40-16-14-33-27(37)10-3-5-13-34-35-32)30-42-20-22(43-30)7-4-6-15-36-28(38)23-8-1-2-9-24(23)29(36)39/h1-2,8-9,11-12,19,22,30H,3-7,10,13-18,20H2,(H,33,37) |
| InChIKey | UXTMAVXYGPNJOD-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 152.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.64 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|