C25H28FNO8 — CID 160569873
ethene;2-[3-[[2-[3-fluoro-4-(trioxidanyl)phenyl]-1,3-dioxan-5-yl]oxy]propyl]isoindole-1,3-dione (PubChem CID 160569873) has the molecular formula C25H28FNO8 and a molecular weight of 489.50 g/mol. Its IUPAC name is ethene;2-[3-[[2-[3-fluoro-4-(trioxidanyl)phenyl]-1,3-dioxan-5-yl]oxy]propyl]isoindole-1,3-dione.
| Compound Name | ethene;2-[3-[[2-[3-fluoro-4-(trioxidanyl)phenyl]-1,3-dioxan-5-yl]oxy]propyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 160569873 |
| Molecular Formula | C25H28FNO8 |
| Molecular Weight | 489.50 g/mol |
| Exact Mass | 489.18 |
| IUPAC Name | ethene;2-[3-[[2-[3-fluoro-4-(trioxidanyl)phenyl]-1,3-dioxan-5-yl]oxy]propyl]isoindole-1,3-dione |
| SMILES | C=C.C=C.O=C1c2ccccc2C(=O)N1CCCOC1COC(c2ccc(OOO)c(F)c2)OC1 |
| InChI | InChI=1S/C21H20FNO8.2C2H4/c22-17-10-13(6-7-18(17)30-31-26)21-28-11-14(12-29-21)27-9-3-8-23-19(24)15-4-1-2-5-16(15)20(23)25;2*1-2/h1-2,4-7,10,14,21,26H,3,8-9,11-12H2;2*1-2H2 |
| InChIKey | RAKDZHOFPMTLMM-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 103.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.50 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|