C22H22FNO7 — CID 153438162
2-[2-[[2-[3-fluoro-4-(2-hydroxyethoxy)phenyl]-1,3-dioxan-5-yl]oxy]ethyl]isoindole-1,3-dione (PubChem CID 153438162) has the molecular formula C22H22FNO7 and a molecular weight of 431.42 g/mol. Its IUPAC name is 2-[2-[[2-[3-fluoro-4-(2-hydroxyethoxy)phenyl]-1,3-dioxan-5-yl]oxy]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[[2-[3-fluoro-4-(2-hydroxyethoxy)phenyl]-1,3-dioxan-5-yl]oxy]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 153438162 |
| Molecular Formula | C22H22FNO7 |
| Molecular Weight | 431.42 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | 2-[2-[[2-[3-fluoro-4-(2-hydroxyethoxy)phenyl]-1,3-dioxan-5-yl]oxy]ethyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCOC1COC(c2ccc(OCCO)c(F)c2)OC1 |
| InChI | InChI=1S/C22H22FNO7/c23-18-11-14(5-6-19(18)29-10-8-25)22-30-12-15(13-31-22)28-9-7-24-20(26)16-3-1-2-4-17(16)21(24)27/h1-6,11,15,22,25H,7-10,12-13H2 |
| InChIKey | BWXLTCQTIMPZQN-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.42 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|