C15H18N2O3 — CID 63870873
2-(2-piperidin-4-yloxyethyl)isoindole-1,3-dione (PubChem CID 63870873) has the molecular formula C15H18N2O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is 2-(2-piperidin-4-yloxyethyl)isoindole-1,3-dione.
| Compound Name | 2-(2-piperidin-4-yloxyethyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 63870873 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 2-(2-piperidin-4-yloxyethyl)isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCOC1CCNCC1 |
| InChI | InChI=1S/C15H18N2O3/c18-14-12-3-1-2-4-13(12)15(19)17(14)9-10-20-11-5-7-16-8-6-11/h1-4,11,16H,5-10H2 |
| InChIKey | OKVKAYDNXUAVFQ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|