C20H22FN2O3+ — CID 8911967
2-(1,3-dioxoisoindol-2-yl)ethyl-ethyl-[(3-fluoro-4-methoxyphenyl)methyl]azanium (PubChem CID 8911967) has the molecular formula C20H22FN2O3+ and a molecular weight of 357.41 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)ethyl-ethyl-[(3-fluoro-4-methoxyphenyl)methyl]azanium.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)ethyl-ethyl-[(3-fluoro-4-methoxyphenyl)methyl]azanium |
|---|---|
| PubChem CID | 8911967 |
| Molecular Formula | C20H22FN2O3+ |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)ethyl-ethyl-[(3-fluoro-4-methoxyphenyl)methyl]azanium |
| SMILES | CC[NH+](CCN1C(=O)c2ccccc2C1=O)Cc1ccc(OC)c(F)c1 |
| InChI | InChI=1S/C20H21FN2O3/c1-3-22(13-14-8-9-18(26-2)17(21)12-14)10-11-23-19(24)15-6-4-5-7-16(15)20(23)25/h4-9,12H,3,10-11,13H2,1-2H3/p+1 |
| InChIKey | YTMPWZXXMMKXJS-UHFFFAOYSA-O |
| XLogP | 1.54 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|