C15H21FN3O3+ — CID 9349421
ethyl-[(3-fluoro-4-methoxyphenyl)methyl]-[2-oxo-2-(2-oxoimidazolidin-1-yl)ethyl]azanium (PubChem CID 9349421) has the molecular formula C15H21FN3O3+ and a molecular weight of 310.35 g/mol. Its IUPAC name is ethyl-[(3-fluoro-4-methoxyphenyl)methyl]-[2-oxo-2-(2-oxoimidazolidin-1-yl)ethyl]azanium.
| Compound Name | ethyl-[(3-fluoro-4-methoxyphenyl)methyl]-[2-oxo-2-(2-oxoimidazolidin-1-yl)ethyl]azanium |
|---|---|
| PubChem CID | 9349421 |
| Molecular Formula | C15H21FN3O3+ |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | ethyl-[(3-fluoro-4-methoxyphenyl)methyl]-[2-oxo-2-(2-oxoimidazolidin-1-yl)ethyl]azanium |
| SMILES | CC[NH+](CC(=O)N1CCNC1=O)Cc1ccc(OC)c(F)c1 |
| InChI | InChI=1S/C15H20FN3O3/c1-3-18(10-14(20)19-7-6-17-15(19)21)9-11-4-5-13(22-2)12(16)8-11/h4-5,8H,3,6-7,9-10H2,1-2H3,(H,17,21)/p+1 |
| InChIKey | AKMWIJQMVJLDJJ-UHFFFAOYSA-O |
| XLogP | -0.21 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |