C18H19F4N2O2+ — CID 9349147
ethyl-[(3-fluoro-4-methoxyphenyl)methyl]-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]azanium (PubChem CID 9349147) has the molecular formula C18H19F4N2O2+ and a molecular weight of 371.35 g/mol. Its IUPAC name is ethyl-[(3-fluoro-4-methoxyphenyl)methyl]-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]azanium.
| Compound Name | ethyl-[(3-fluoro-4-methoxyphenyl)methyl]-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]azanium |
|---|---|
| PubChem CID | 9349147 |
| Molecular Formula | C18H19F4N2O2+ |
| Molecular Weight | 371.35 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | ethyl-[(3-fluoro-4-methoxyphenyl)methyl]-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]azanium |
| SMILES | CC[NH+](CC(=O)Nc1ccc(F)c(F)c1F)Cc1ccc(OC)c(F)c1 |
| InChI | InChI=1S/C18H18F4N2O2/c1-3-24(9-11-4-7-15(26-2)13(20)8-11)10-16(25)23-14-6-5-12(19)17(21)18(14)22/h4-8H,3,9-10H2,1-2H3,(H,23,25)/p+1 |
| InChIKey | VSMJIJRJPSKAGM-UHFFFAOYSA-O |
| XLogP | 2.30 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.35 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|