C19H22F3N2O3+ — CID 8584090
2-(3,4-dimethoxyphenyl)ethyl-methyl-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]azanium (PubChem CID 8584090) has the molecular formula C19H22F3N2O3+ and a molecular weight of 383.39 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)ethyl-methyl-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]azanium.
| Compound Name | 2-(3,4-dimethoxyphenyl)ethyl-methyl-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]azanium |
|---|---|
| PubChem CID | 8584090 |
| Molecular Formula | C19H22F3N2O3+ |
| Molecular Weight | 383.39 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)ethyl-methyl-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]azanium |
| SMILES | COc1ccc(CC[NH+](C)CC(=O)Nc2ccc(F)c(F)c2F)cc1OC |
| InChI | InChI=1S/C19H21F3N2O3/c1-24(9-8-12-4-7-15(26-2)16(10-12)27-3)11-17(25)23-14-6-5-13(20)18(21)19(14)22/h4-7,10H,8-9,11H2,1-3H3,(H,23,25)/p+1 |
| InChIKey | JHIVIYYCLLBDNJ-UHFFFAOYSA-O |
| XLogP | 1.82 |
| TPSA | 52.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.39 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|