C20H21FN2O3 — CID 75472337
2-[4-(3-fluoro-4-methoxyanilino)pentyl]isoindole-1,3-dione (PubChem CID 75472337) has the molecular formula C20H21FN2O3 and a molecular weight of 356.40 g/mol. Its IUPAC name is 2-[4-(3-fluoro-4-methoxyanilino)pentyl]isoindole-1,3-dione.
| Compound Name | 2-[4-(3-fluoro-4-methoxyanilino)pentyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 75472337 |
| Molecular Formula | C20H21FN2O3 |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 2-[4-(3-fluoro-4-methoxyanilino)pentyl]isoindole-1,3-dione |
| SMILES | COc1ccc(NC(C)CCCN2C(=O)c3ccccc3C2=O)cc1F |
| InChI | InChI=1S/C20H21FN2O3/c1-13(22-14-9-10-18(26-2)17(21)12-14)6-5-11-23-19(24)15-7-3-4-8-16(15)20(23)25/h3-4,7-10,12-13,22H,5-6,11H2,1-2H3 |
| InChIKey | BNFWBIBNEKGFMZ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|