C19H24N4O2 — CID 75446840
2-[4-[(1-propylpyrazol-4-yl)amino]pentyl]isoindole-1,3-dione (PubChem CID 75446840) has the molecular formula C19H24N4O2 and a molecular weight of 340.43 g/mol. Its IUPAC name is 2-[4-[(1-propylpyrazol-4-yl)amino]pentyl]isoindole-1,3-dione.
| Compound Name | 2-[4-[(1-propylpyrazol-4-yl)amino]pentyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 75446840 |
| Molecular Formula | C19H24N4O2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | 2-[4-[(1-propylpyrazol-4-yl)amino]pentyl]isoindole-1,3-dione |
| SMILES | CCCn1cc(NC(C)CCCN2C(=O)c3ccccc3C2=O)cn1 |
| InChI | InChI=1S/C19H24N4O2/c1-3-10-22-13-15(12-20-22)21-14(2)7-6-11-23-18(24)16-8-4-5-9-17(16)19(23)25/h4-5,8-9,12-14,21H,3,6-7,10-11H2,1-2H3 |
| InChIKey | DQARHGBOKTVQOA-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|